product Name |
thiocyanic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) |
Synonyms |
Thiocyanic acid, compound with 2,2',2''-nitrilotris(ethanol) (1:1); Caswell No. 887F; EPA Pesticide Chemical Code 068105; Triethanolamine thiocyanate; Thiocyanic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); 6-[(4-methylbenzyl)oxy]-2-{[4-(1-methylethyl)phenyl]methylidene}-1-benzofuran-3(2H)-one; 2-(bis(2-hydroxyethyl)amino)ethanol thiocyanate |
Molecular Formula |
C7H15N2O3S |
Molecular Weight |
207.2711 |
InChI |
InChI=1/C6H15NO3.CHNS/c8-4-1-7(2-5-9)3-6-10;2-1-3/h8-10H,1-6H2;3H/p-1 |
CAS Registry Number |
7048-26-2 |
EINECS |
230-327-6 |
Molecular Structure |
|
Boiling point |
335.4°C at 760 mmHg |
Flash point |
185°C |
Vapour Pressur |
8.38E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|