| product Name |
4-Benzyloxyindole-3-carboxaldehyde |
| Synonyms |
4-Benzyloxy-3-formylindole; 4-(benzyloxy)-1H-indole-3-carbaldehyde |
| Molecular Formula |
C16H13NO2 |
| Molecular Weight |
251.2799 |
| InChI |
InChI=1/C16H13NO2/c18-10-13-9-17-14-7-4-8-15(16(13)14)19-11-12-5-2-1-3-6-12/h1-10,17H,11H2 |
| CAS Registry Number |
7042-71-9 |
| Molecular Structure |
|
| Density |
1.267g/cm3 |
| Boiling point |
474.2°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
240.6°C |
| Vapour Pressur |
3.7E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|