| product Name |
sym-Dibenzoylhydrazine |
| Synonyms |
N,N-Dibenzoylhydrazine; NN-Dibenzoylhydrazine; N,N-Dibenzhydrazide; N'-benzoylbenzohydrazide |
| Molecular Formula |
C14H12N2O2 |
| Molecular Weight |
240.2573 |
| InChI |
InChI=1/C14H12N2O2/c17-13(11-7-3-1-4-8-11)15-16-14(18)12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18) |
| CAS Registry Number |
787-84-8 |
| EINECS |
212-329-9 |
| Molecular Structure |
|
| Density |
1.213g/cm3 |
| Melting point |
238.5-240.5℃ |
| Boiling point |
485.6°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
202.8°C |
| Vapour Pressur |
1.39E-09mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
