| product Name |
N-(4-fluorophenyl)maleamic acid |
| Synonyms |
Maleic acid mono(4-fluorophenyl)amide; (2Z)-4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid |
| Molecular Formula |
C10H8FNO3 |
| Molecular Weight |
209.1738 |
| InChI |
InChI=1/C10H8FNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5- |
| CAS Registry Number |
780-05-2 |
| Molecular Structure |
|
| Density |
1.413g/cm3 |
| Melting point |
207-209℃ |
| Boiling point |
437.3°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
218.2°C |
| Vapour Pressur |
2.03E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
