| product Name |
1,3,5-Triacetylbenzene |
| Synonyms |
1,3,5,Triacetylbenzene; 1,1',1''-benzene-1,3,5-triyltriethanone |
| Molecular Formula |
C12H12O3 |
| Molecular Weight |
204.2219 |
| InChI |
InChI=1/C12H12O3/c1-7(13)10-4-11(8(2)14)6-12(5-10)9(3)15/h4-6H,1-3H3 |
| CAS Registry Number |
779-90-8 |
| EINECS |
212-302-1 |
| Molecular Structure |
|
| Density |
1.109g/cm3 |
| Melting point |
160-164℃ |
| Boiling point |
367.5°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
158.7°C |
| Vapour Pressur |
1.36E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
