| product Name |
3-acetamidocoumarin |
| Synonyms |
3-Acetamidocoumarin; N-(2-oxo-2H-chromen-3-yl)acetamide |
| Molecular Formula |
C11H9NO3 |
| Molecular Weight |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-7(13)12-9-6-8-4-2-3-5-10(8)15-11(9)14/h2-6H,1H3,(H,12,13) |
| CAS Registry Number |
779-30-6 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
205-207℃ |
| Boiling point |
482°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
245.3°C |
| Vapour Pressur |
1.89E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
