| product Name |
4-Nitrophenyl chloroacetate |
| Synonyms |
2-Chloro-4-nitrophenyl acetate; AI3-23373; Acetic acid, chloro-, 4-nitrophenyl ester |
| Molecular Formula |
C8H6ClNO4 |
| Molecular Weight |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2 |
| CAS Registry Number |
777-84-4;79328-69-1 |
| Molecular Structure |
|
| Density |
1.434g/cm3 |
| Melting point |
73-75℃ |
| Boiling point |
334.5°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
156.1°C |
| Vapour Pressur |
0.000128mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
