| product Name |
1-(5,6,7,8-Tetrahydro-2-naphthalenyl)-ethanone |
| Synonyms |
6-Acetyltetralin; 1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| Molecular Formula |
C12H14O |
| Molecular Weight |
174.239 |
| InChI |
InChI=1/C12H14O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h6-8H,2-5H2,1H3 |
| CAS Registry Number |
774-55-0 |
| EINECS |
212-266-7 |
| Molecular Structure |
|
| Density |
1.038g/cm3 |
| Boiling point |
312.4°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
133.9°C |
| Vapour Pressur |
0.00053mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
