| product Name |
2,4,6-Trimethylpyrylium tetrafluoroborate |
| Synonyms |
Pyrylium, 2,4,6-trimethyl-, tetrafluoroborate(1-) (1:1); 2,4,6-Trimethylpyrylium tetrafluoborate; AI3-61775; Pyrylium, 2,4,6-trimethyl-, tetrafluoroborate(1-); 2,4,6-trimethylpyranium; 2,4,6-trimethylpyranium tetrafluoroborate |
| Molecular Formula |
C8H11BF4O |
| Molecular Weight |
209.977 |
| InChI |
InChI=1/C8H11O.BF4/c1-6-4-7(2)9-8(3)5-6;2-1(3,4)5/h4-5H,1-3H3;/q+1;-1 |
| CAS Registry Number |
773-01-3 |
| EINECS |
212-256-2 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
