| product Name |
2,4,6-Trimethylstyrene |
| Synonyms |
Vinylmesitylene; 2-ethenyl-1,3,5-trimethylbenzene |
| Molecular Formula |
C11H14 |
| Molecular Weight |
146.2289 |
| InChI |
InChI=1/C11H14/c1-5-11-9(3)6-8(2)7-10(11)4/h5-7H,1H2,2-4H3 |
| CAS Registry Number |
769-25-5 |
| EINECS |
212-205-4 |
| Molecular Structure |
|
| Density |
0.89g/cm3 |
| Boiling point |
207.2°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
71.8°C |
| Vapour Pressur |
0.329mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
