| product Name |
2,3-Dimethylmaleic anhydride |
| Synonyms |
3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione |
| Molecular Formula |
C6H6O3 |
| Molecular Weight |
126.11 |
| InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
| CAS Registry Number |
766-39-2 |
| EINECS |
212-165-8 |
| Molecular Structure |
|
| Density |
1.236g/cm3 |
| Melting point |
93-96℃ |
| Boiling point |
223°C at 760 mmHg |
| Refractive index |
1.486 |
| Flash point |
95.6°C |
| Vapour Pressur |
0.0986mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
