product Name |
Cyclobutanecarboxylic acid methyl ester |
Synonyms |
Methyl cyclobutanecarboxylate |
Molecular Formula |
C6H10O2 |
Molecular Weight |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-8-6(7)5-3-2-4-5/h5H,2-4H2,1H3 |
CAS Registry Number |
765-85-5 |
Molecular Structure |
|
Density |
1.051g/cm3 |
Boiling point |
138.7°C at 760 mmHg |
Refractive index |
1.453 |
Flash point |
30.1°C |
Vapour Pressur |
6.64mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|