product Name |
triethylammonium sulphamate |
Synonyms |
Sulfamic acid, compd. with N,N-diethylethanamine (1:1); Sulfamic acid, compd. with triethylamine (1:1); Triethylamine sulfamate; Triethylammonium sulphamate; sulfamic acid - N,N-diethylethanamine (1:1) |
Molecular Formula |
C6H18N2O3S |
Molecular Weight |
198.2837 |
InChI |
InChI=1/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
CAS Registry Number |
761-02-4 |
EINECS |
212-087-4 |
Molecular Structure |
|
Boiling point |
90.5°C at 760 mmHg |
Flash point |
152.2°C |
Vapour Pressur |
56.1mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|