| product Name |
triethylammonium sulphamate |
| Synonyms |
Sulfamic acid, compd. with N,N-diethylethanamine (1:1); Sulfamic acid, compd. with triethylamine (1:1); Triethylamine sulfamate; Triethylammonium sulphamate; sulfamic acid - N,N-diethylethanamine (1:1) |
| Molecular Formula |
C6H18N2O3S |
| Molecular Weight |
198.2837 |
| InChI |
InChI=1/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
| CAS Registry Number |
761-02-4 |
| EINECS |
212-087-4 |
| Molecular Structure |
|
| Boiling point |
90.5°C at 760 mmHg |
| Flash point |
152.2°C |
| Vapour Pressur |
56.1mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|