product Name |
N,N-Dimethylbutyramide |
Synonyms |
Butanamide, N,N-dimethyl-; 4-04-00-00185 (Beilstein Handbook Reference); AI3-36713; BRN 1742172; Butyramide, N,N-dimethyl-; N,N-Dimethyl-n-butyramide; N,N-Dimethylbutanamide; NSC 54115 |
Molecular Formula |
C6H13NO |
Molecular Weight |
115.1735 |
InChI |
InChI=1/C6H13NO/c1-4-5-6(8)7(2)3/h4-5H2,1-3H3 |
CAS Registry Number |
760-79-2 |
Molecular Structure |
|
Density |
0.872g/cm3 |
Boiling point |
186.5°C at 760 mmHg |
Refractive index |
1.422 |
Flash point |
69.3°C |
Vapour Pressur |
0.661mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|