| product Name |
N,N-Dimethylbutyramide |
| Synonyms |
Butanamide, N,N-dimethyl-; 4-04-00-00185 (Beilstein Handbook Reference); AI3-36713; BRN 1742172; Butyramide, N,N-dimethyl-; N,N-Dimethyl-n-butyramide; N,N-Dimethylbutanamide; NSC 54115 |
| Molecular Formula |
C6H13NO |
| Molecular Weight |
115.1735 |
| InChI |
InChI=1/C6H13NO/c1-4-5-6(8)7(2)3/h4-5H2,1-3H3 |
| CAS Registry Number |
760-79-2 |
| Molecular Structure |
|
| Density |
0.872g/cm3 |
| Boiling point |
186.5°C at 760 mmHg |
| Refractive index |
1.422 |
| Flash point |
69.3°C |
| Vapour Pressur |
0.661mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|