| product Name |
3,4-Dichloro-1-butene |
| Synonyms |
Dichlorobutene; 3,4-Dichlorobutene-1; 3,4-dichlorobut-1-ene |
| Molecular Formula |
C4H6Cl2 |
| Molecular Weight |
124.9964 |
| InChI |
InChI=1/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
| CAS Registry Number |
760-23-6 |
| EINECS |
212-079-0 |
| Molecular Structure |
|
| Density |
1.108g/cm3 |
| Melting point |
-61℃ |
| Boiling point |
116°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
28.3°C |
| Vapour Pressur |
22.1mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|