product Name |
Acetic acid-d |
Synonyms |
Acetic acid-d1; acetate; (O-~2~H)acetic acid |
Molecular Formula |
C2H3DO2 |
Molecular Weight |
61.0581 |
InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
CAS Registry Number |
758-12-3 |
EINECS |
212-059-1 |
Molecular Structure |
|
Density |
1.086g/cm3 |
Melting point |
15-16℃ |
Boiling point |
117.1°C at 760 mmHg |
Refractive index |
1.375 |
Flash point |
40°C |
Vapour Pressur |
13.9mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R10:Flammable.;
R35:Causes severe burns.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|