| product Name |
benethamine penicillin |
| Synonyms |
N-benzylphenethylammonium 6-phenylacetamidopenicillanate; 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid - N-benzyl-2-phenylethanamine (1:1) |
| Molecular Formula |
C31H35N3O4S |
| Molecular Weight |
545.6923 |
| InChI |
InChI=1/C16H18N2O4S.C15H17N/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,16H,11-13H2/t11-,12+,14-;/m1./s1 |
| CAS Registry Number |
751-84-8 |
| EINECS |
212-029-8 |
| Molecular Structure |
|
| Boiling point |
663.3°C at 760 mmHg |
| Flash point |
355°C |
| Vapour Pressur |
1.69E-18mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|