| product Name |
methyl 11,17-dimethoxy-18-(tetrahydro-2H-pyran-2-yloxy)yohimban-16-carboxylate |
| Synonyms |
|
| Molecular Formula |
C28H38N2O6 |
| Molecular Weight |
498.6111 |
| InChI |
InChI=1/C28H38N2O6/c1-32-17-7-8-18-19-9-10-30-15-16-12-23(36-24-6-4-5-11-35-24)27(33-2)25(28(31)34-3)20(16)14-22(30)26(19)29-21(18)13-17/h7-8,13,16,20,22-25,27,29H,4-6,9-12,14-15H2,1-3H3 |
| CAS Registry Number |
751-73-5 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
638.9°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
340.2°C |
| Vapour Pressur |
3.21E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|