| product Name |
Hydroxychloroquine Sulphate |
| Synonyms |
Hydroxy chloroquine sulfate; Hydrochloroquine Sulfate; 7-chloro-4-({(1R)-4-[ethyl(2-hydroxyethyl)ammonio]-1-methylbutyl}amino)quinolinium; 7-chloro-4-({(1S)-4-[ethyl(2-hydroxyethyl)ammonio]-1-methylbutyl}amino)quinolinium |
| Molecular Formula |
C18H28ClN3O |
| Molecular Weight |
337.8863 |
| InChI |
InChI=1/C18H26ClN3O/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21)/p+2/t14-/m0/s1 |
| CAS Registry Number |
747-36-4 |
| EINECS |
212-019-3 |
| Molecular Structure |
|
| Melting point |
240℃ |
| Boiling point |
516.7°C at 760 mmHg |
| Flash point |
266.3°C |
| Water solubility |
FREELY SOLUBLE |
| Vapour Pressur |
1.68E-11mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|