| product Name |
Prostaglandin E1 |
| Synonyms |
ALPROSTADIL; Prostaglandin E1 or AIPROSTADIL; Alprostadil (prostandin E1); 11,15-dihydroxy-9-oxoprost-13-en-1-oic acid; (11alpha,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oic acid; (11alpha,12xi,13E,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oic acid; (11alpha,13E,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oate |
| Molecular Formula |
C20H33O5 |
| Molecular Weight |
353.4736 |
| InChI |
InChI=1/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/p-1/b13-12+/t15-,16+,17+,19+/m0/s1 |
| CAS Registry Number |
745-65-3 |
| EINECS |
212-017-2 |
| Molecular Structure |
|
| Melting point |
115-116℃ |
| Boiling point |
529.282°C at 760 mmHg |
| Flash point |
287.975°C |
| Water solubility |
insoluble |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S36:;
|
|