| product Name |
5-(butan-2-yl)-1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
|
| Molecular Formula |
C20H32N2O3 |
| Molecular Weight |
348.4797 |
| InChI |
InChI=1/C20H32N2O3/c1-3-14(2)17-18(23)21(15-10-6-4-7-11-15)20(25)22(19(17)24)16-12-8-5-9-13-16/h14-17H,3-13H2,1-2H3 |
| CAS Registry Number |
745-31-3 |
| Molecular Structure |
|
| Density |
1.135g/cm3 |
| Boiling point |
453.9°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
177.1°C |
| Vapour Pressur |
1.99E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|