| product Name |
N,N'-benzene-1,2-diyldibenzamide |
| Synonyms |
benzamide, N,N'-1,2-phenylenebis-; N,N'-1,2-Phenylenedibenzamide |
| Molecular Formula |
C20H16N2O2 |
| Molecular Weight |
316.3532 |
| InChI |
InChI=1/C20H16N2O2/c23-19(15-9-3-1-4-10-15)21-17-13-7-8-14-18(17)22-20(24)16-11-5-2-6-12-16/h1-14H,(H,21,23)(H,22,24) |
| CAS Registry Number |
744-38-7 |
| Molecular Structure |
|
| Density |
1.279g/cm3 |
| Boiling point |
358.2°C at 760 mmHg |
| Refractive index |
1.698 |
| Flash point |
103.8°C |
| Vapour Pressur |
2.59E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|