| product Name |
1,3-diphenyl-5-propylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
|
| Molecular Formula |
C19H18N2O3 |
| Molecular Weight |
322.3578 |
| InChI |
InChI=1/C19H18N2O3/c1-2-9-16-17(22)20(14-10-5-3-6-11-14)19(24)21(18(16)23)15-12-7-4-8-13-15/h3-8,10-13,16H,2,9H2,1H3 |
| CAS Registry Number |
743-44-2 |
| Molecular Structure |
|
| Density |
1.237g/cm3 |
| Boiling point |
449.8°C at 760 mmHg |
| Refractive index |
1.597 |
| Flash point |
190.6°C |
| Vapour Pressur |
2.79E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|