| product Name |
1,3-dicyclohexyl-5-(propan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
|
| Molecular Formula |
C19H30N2O3 |
| Molecular Weight |
334.4531 |
| InChI |
InChI=1/C19H30N2O3/c1-13(2)16-17(22)20(14-9-5-3-6-10-14)19(24)21(18(16)23)15-11-7-4-8-12-15/h13-16H,3-12H2,1-2H3 |
| CAS Registry Number |
743-40-8 |
| Molecular Structure |
|
| Density |
1.151g/cm3 |
| Boiling point |
441.1°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
174.1°C |
| Vapour Pressur |
5.61E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|