| product Name |
hippuryl-lys |
| Synonyms |
Hippuryl-Lys-OH; N-benzoylglycyllysine |
| Molecular Formula |
C15H21N3O4 |
| Molecular Weight |
307.3449 |
| InChI |
InChI=1/C15H21N3O4/c16-9-5-4-8-12(15(21)22)18-13(19)10-17-14(20)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,16H2,(H,17,20)(H,18,19)(H,21,22) |
| CAS Registry Number |
740-63-6 |
| Molecular Structure |
|
| Density |
1.229g/cm3 |
| Boiling point |
662.3°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
354.3°C |
| Vapour Pressur |
1.93E-18mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|