| product Name |
5-methyl-1,3-diphenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-methyl-1,3-diphenyl-; Barbituric acid, 5-methyl-1,3-diphenyl- |
| Molecular Formula |
C17H14N2O3 |
| Molecular Weight |
294.3047 |
| InChI |
InChI=1/C17H14N2O3/c1-12-15(20)18(13-8-4-2-5-9-13)17(22)19(16(12)21)14-10-6-3-7-11-14/h2-12H,1H3 |
| CAS Registry Number |
739-50-4 |
| Molecular Structure |
|
| Density |
1.299g/cm3 |
| Boiling point |
425.9°C at 760 mmHg |
| Refractive index |
1.62 |
| Flash point |
185.9°C |
| Vapour Pressur |
1.85E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|