| product Name |
1,3-dicyclohexyl-5-methylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
|
| Molecular Formula |
C17H26N2O3 |
| Molecular Weight |
306.3999 |
| InChI |
InChI=1/C17H26N2O3/c1-12-15(20)18(13-8-4-2-5-9-13)17(22)19(16(12)21)14-10-6-3-7-11-14/h12-14H,2-11H2,1H3 |
| CAS Registry Number |
739-49-1 |
| Molecular Structure |
|
| Density |
1.186g/cm3 |
| Boiling point |
420.1°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
171.4°C |
| Vapour Pressur |
2.89E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|