| product Name |
9,9-dimethyl-10-phenyl-9,10-dihydroanthracene |
| Synonyms |
|
| Molecular Formula |
C22H20 |
| Molecular Weight |
284.3942 |
| InChI |
InChI=1/C22H20/c1-22(2)19-14-8-6-12-17(19)21(16-10-4-3-5-11-16)18-13-7-9-15-20(18)22/h3-15,21H,1-2H3 |
| CAS Registry Number |
739-45-7 |
| Molecular Structure |
|
| Density |
1.058g/cm3 |
| Boiling point |
391.2°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
186.2°C |
| Vapour Pressur |
5.67E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|