| product Name |
4-[(2R,5R,6E)-2-hydroxy-5,7-dimethyl-4-oxonona-6,8-dien-1-yl]piperidine-2,6-dione |
| Synonyms |
|
| Molecular Formula |
C16H23NO4 |
| Molecular Weight |
293.3581 |
| InChI |
InChI=1/C16H23NO4/c1-4-10(2)5-11(3)14(19)9-13(18)6-12-7-15(20)17-16(21)8-12/h4-5,11-13,18H,1,6-9H2,2-3H3,(H,17,20,21)/b10-5+/t11-,13-/m1/s1 |
| CAS Registry Number |
738-72-7 |
| Density |
1.104g/cm3 |
| Boiling point |
507.6°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
260.8°C |
| Vapour Pressur |
1.98E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|