| product Name |
N-(2-chloro-5-ethylphenyl)-3-(morpholin-4-yl)butanamide |
| Synonyms |
|
| Molecular Formula |
C16H23ClN2O2 |
| Molecular Weight |
310.819 |
| InChI |
InChI=1/C16H23ClN2O2/c1-3-13-4-5-14(17)15(11-13)18-16(20)10-12(2)19-6-8-21-9-7-19/h4-5,11-12H,3,6-10H2,1-2H3,(H,18,20) |
| CAS Registry Number |
738-52-3 |
| Molecular Structure |
|
| Density |
1.182g/cm3 |
| Boiling point |
472.4°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
239.5°C |
| Vapour Pressur |
4.28E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|