| product Name |
2-(3,4-dimethoxyphenyl)-3-phenylprop-2-enoic acid |
| Synonyms |
|
| Molecular Formula |
C17H16O4 |
| Molecular Weight |
284.3065 |
| InChI |
InChI=1/C17H16O4/c1-20-15-9-8-13(11-16(15)21-2)14(17(18)19)10-12-6-4-3-5-7-12/h3-11H,1-2H3,(H,18,19) |
| CAS Registry Number |
738-25-0 |
| Molecular Structure |
|
| Density |
1.209g/cm3 |
| Boiling point |
412.3°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
148°C |
| Vapour Pressur |
1.55E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|