| product Name |
trans-4,4'-dinitrostilbene |
| Synonyms |
Benzene, 1,1'-(1,2-ethenediyl)bis(4-nitro-, (E)-; (E)-1,1'-(1,2-Ethenediyl)bis(4-nitrobenzene); (E)-4,4'-Dinitrostilbene; (E)-p,p'-Dinitrostilbene; CCRIS 8546; Stilbene, 4,4'-dinitro-, (E)-; trans-4,4'-Dinitrostilbene |
| Molecular Formula |
C14H10N2O4 |
| Molecular Weight |
270.2403 |
| InChI |
InChI=1S/C14H10N2O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H/b2-1+ |
| CAS Registry Number |
736-31-2 |
| EINECS |
212-002-0 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|