| product Name |
N-(2-chloro-5-ethylphenyl)-3-(diethylamino)butanamide |
| Synonyms |
|
| Molecular Formula |
C16H25ClN2O |
| Molecular Weight |
296.8355 |
| InChI |
InChI=1/C16H25ClN2O/c1-5-13-8-9-14(17)15(11-13)18-16(20)10-12(4)19(6-2)7-3/h8-9,11-12H,5-7,10H2,1-4H3,(H,18,20) |
| CAS Registry Number |
736-20-9 |
| Molecular Structure |
|
| Density |
1.083g/cm3 |
| Boiling point |
423.2°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
209.7°C |
| Vapour Pressur |
2.27E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|