| product Name |
4-(diethylamino)-N-(5-ethyl-2-fluorophenyl)butanamide |
| Synonyms |
|
| Molecular Formula |
C16H25FN2O |
| Molecular Weight |
280.3809 |
| InChI |
InChI=1/C16H25FN2O/c1-4-13-9-10-14(17)15(12-13)18-16(20)8-7-11-19(5-2)6-3/h9-10,12H,4-8,11H2,1-3H3,(H,18,20) |
| CAS Registry Number |
736-12-9 |
| Molecular Structure |
|
| Density |
1.054g/cm3 |
| Boiling point |
409.1°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
201.2°C |
| Vapour Pressur |
6.68E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|