| product Name |
N'-[(1E)-1,3-benzodioxol-5-ylmethylidene]pyridine-4-carbohydrazide |
| Synonyms |
4-pyridinecarboxylic acid, 2-[(1E)-1,3-benzodioxol-5-ylmethylene]hydrazide; N'-[(E)-1,3-Benzodioxol-5-ylmethylene]isonicotinohydrazide |
| Molecular Formula |
C14H11N3O3 |
| Molecular Weight |
269.2554 |
| InChI |
InChI=1/C14H11N3O3/c18-14(11-3-5-15-6-4-11)17-16-8-10-1-2-12-13(7-10)20-9-19-12/h1-8H,9H2,(H,17,18)/b16-8+ |
| CAS Registry Number |
735-97-7 |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Refractive index |
1.654 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|