product Name |
Butyl methacrylate/isobutyl methacrylate copolymer |
Synonyms |
Poly(butyl methacrylate-co-isobutyl methacrylate); butyl 2-methylprop-2-enoate; (E)-2,5-dimethylhex-2-enoate |
Molecular Formula |
C16H27O4 |
Molecular Weight |
283.3837 |
InChI |
InChI=1/2C8H14O2/c1-6(2)4-5-7(3)8(9)10;1-4-5-6-10-8(9)7(2)3/h5-6H,4H2,1-3H3,(H,9,10);2,4-6H2,1,3H3/p-1/b7-5+; |
CAS Registry Number |
9011-53-4 |
Molecular Structure |
|
Boiling point |
160°C at 760 mmHg |
Flash point |
50.6°C |
Vapour Pressur |
2.44mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|