| product Name |
N'-benzoyl-4-fluorobenzohydrazide |
| Synonyms |
benzoic acid, 4-fluoro-, 2-benzoylhydrazide; N'-Benzoyl-4-fluorobenzohydrazide |
| Molecular Formula |
C14H11FN2O2 |
| Molecular Weight |
258.2477 |
| InChI |
InChI=1/C14H11FN2O2/c15-12-8-6-11(7-9-12)14(19)17-16-13(18)10-4-2-1-3-5-10/h1-9H,(H,16,18)(H,17,19) |
| CAS Registry Number |
732-95-6 |
| Molecular Structure |
|
| Density |
1.277g/cm3 |
| Boiling point |
497.8°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
254.9°C |
| Vapour Pressur |
4.78E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|