| product Name |
Methyl vinyl ether/maleic anhydride copolymer |
| Synonyms |
Poly(methyl vinyl ether-alt-maleic anhydride) |
| Molecular Formula |
C7H8O4 |
| Molecular Weight |
156.136 |
| InChI |
InChI=1/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3-4-2/h1-2H;3H,1H2,2H3 |
| CAS Registry Number |
9011-16-9 |
| Molecular Structure |
|
| Boiling point |
202°C at 760 mmHg |
| Flash point |
103.3°C |
| Vapour Pressur |
0.299mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
