| product Name |
1,3,5-tris(trifluoromethyl)benzene |
| Synonyms |
Benzene, 1,3,5-tris(trifluoromethyl)-; 1,3,5-Tris(trifluoromethyl)benzene |
| Molecular Formula |
C7H4FNO4 |
| Molecular Weight |
185.1094 |
| InChI |
InChI=1/C7H4FNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
| CAS Registry Number |
729-81-7 |
| Molecular Structure |
|
| Density |
1.568g/cm3 |
| Boiling point |
337.7°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
158°C |
| Vapour Pressur |
4.03E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/37/38:;
|
| Safety Description |
S16:;
S26:;
S36:;
|
|