| product Name |
4'-nitrobiphenyl-3-carboxylic acid |
| Synonyms |
|
| Molecular Formula |
C13H9NO4 |
| Molecular Weight |
243.2149 |
| InChI |
InChI=1/C13H9NO4/c15-13(16)11-3-1-2-10(8-11)9-4-6-12(7-5-9)14(17)18/h1-8H,(H,15,16) |
| CAS Registry Number |
729-01-1 |
| Molecular Structure |
|
| Density |
1.358g/cm3 |
| Boiling point |
470.2°C at 760 mmHg |
| Refractive index |
1.637 |
| Flash point |
203.2°C |
| Vapour Pressur |
1.21E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|