| product Name |
1-phenyl-4-(piperidin-1-yl)pyrrolidin-2-one |
| Synonyms |
1-Phenyl-4-(piperidin-1-yl)pyrrolidin-2-one; 2-pyrrolidinone, 1-phenyl-4-(1-piperidinyl)- |
| Molecular Formula |
C15H20N2O |
| Molecular Weight |
244.3321 |
| InChI |
InChI=1/C15H20N2O/c18-15-11-14(16-9-5-2-6-10-16)12-17(15)13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2 |
| CAS Registry Number |
728-53-0 |
| Molecular Structure |
|
| Density |
1.154g/cm3 |
| Boiling point |
434.3°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
199.1°C |
| Vapour Pressur |
9.61E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|