| product Name |
coenzyme Q1 |
| Molecular Formula |
C14H18O4 |
| Molecular Weight |
250.2903 |
| InChI |
InChI=1/C14H18O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6H,7H2,1-5H3 |
| CAS Registry Number |
727-81-1 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Boiling point |
389.1°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
172°C |
| Vapour Pressur |
2.92E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|