| product Name |
Ethylene/acrylic acid copolymer |
| Synonyms |
Poly(ethylene-co-acrylic acid); Ethylene-acrylic acid resin (90/10; prop-2-enoic acid - ethene (1:1) |
| Molecular Formula |
C5H8O2 |
| Molecular Weight |
100.1158 |
| InChI |
InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS Registry Number |
9010-77-9 |
| Molecular Structure |
|
| Melting point |
87-101℃ |
| Boiling point |
141°C at 760 mmHg |
| Flash point |
61.6°C |
| Vapour Pressur |
3.42mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
