product Name |
Methylhydroquinone diacetate |
Synonyms |
2,5-Diacetoxytoluene; 2-methylbenzene-1,4-diyl diacetate |
Molecular Formula |
C11H12O4 |
Molecular Weight |
208.2106 |
InChI |
InChI=1/C11H12O4/c1-7-6-10(14-8(2)12)4-5-11(7)15-9(3)13/h4-6H,1-3H3 |
CAS Registry Number |
717-27-1 |
Molecular Structure |
|
Density |
1.15g/cm3 |
Boiling point |
289.7°C at 760 mmHg |
Refractive index |
1.505 |
Flash point |
140.2°C |
Vapour Pressur |
0.00217mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|