product Name |
6-Nitropiperonal |
Synonyms |
6-Nitropiperonal, (3,4-Methylenedioxy-6-nitrobenzald; 4,5-Methylenedioxy-2-nitrobenzaldehyde~6-Nitro-1,3-benzodioxole-5-carboxaldehyde; 6-nitro-1,3-benzodioxole-5-carbaldehyde |
Molecular Formula |
C8H5NO5 |
Molecular Weight |
195.129 |
InChI |
InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
CAS Registry Number |
712-97-0 |
EINECS |
211-926-1 |
Molecular Structure |
|
Density |
1.572g/cm3 |
Melting point |
93-96℃ |
Boiling point |
365.9°C at 760 mmHg |
Refractive index |
1.658 |
Flash point |
195°C |
Vapour Pressur |
1.52E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|