product Name |
2-Acetyl-1-naphthol |
Molecular Formula |
C12H10O2 |
Molecular Weight |
186.2066 |
InChI |
InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
CAS Registry Number |
711-79-5 |
EINECS |
211-918-8 |
Molecular Structure |
|
Density |
1.213g/cm3 |
Melting point |
97-100℃ |
Boiling point |
334.9°C at 760 mmHg |
Refractive index |
1.65 |
Flash point |
142.4°C |
Vapour Pressur |
6.37E-05mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|