product Name |
1,2-Dimethoxy-4-nitrobenzene |
Synonyms |
4-Nitroveratrole; 1,2-dimethoxy-4-nitro-benzen; 3,4-Dimethoxynitrobenzene; 4-Nitrcveratrole; 4-NITRO-1,2-DIMETHOXYBENZENE; 4-Nitroveratrole, 98+%; Benzene, 1,2-dimethoxy-4-nitro-; 3-iodo-4-methylbenzoic acid |
Molecular Formula |
C8H7IO2 |
Molecular Weight |
262.0444 |
InChI |
InChI=1/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
CAS Registry Number |
709-09-1 |
EINECS |
211-906-2 |
Molecular Structure |
|
Density |
1.867g/cm3 |
Melting point |
95-98℃ |
Boiling point |
355.2°C at 760 mmHg |
Refractive index |
1.645 |
Flash point |
168.6°C |
Vapour Pressur |
1.16E-05mmHg at 25°C |
Hazard Symbols |
Xn,Xi:;
|
Risk Codes |
22:;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|