product Name |
3-Phenyl-2-oxazolidinone |
Synonyms |
NSC 37752; 3-phenyl-1,3-oxazolidin-2-one |
Molecular Formula |
C9H9NO2 |
Molecular Weight |
163.1733 |
InChI |
InChI=1/C9H9NO2/c11-9-10(6-7-12-9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
CAS Registry Number |
703-56-0 |
Molecular Structure |
|
Density |
1.24g/cm3 |
Boiling point |
251.6°C at 760 mmHg |
Refractive index |
1.577 |
Flash point |
106°C |
Vapour Pressur |
0.0203mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|