| product Name |
1-Naphthylmagnesium bromide |
| Synonyms |
1-Naphthylmagnesiumbromide (6CI); Magnesium, bromo-1-naphthyl- (7CI,8CI); 1-Naphthalenylmagnesiumbromide; 1-Naphthomagnesium bromide; a-Naphthylmagnesium bromide; Magnesium, bromo-1-naphthalenyl-; magnesium bromide naphthalen-1-ide (1:1:1) |
| Molecular Formula |
C10H7BrMg |
| Molecular Weight |
231.3716 |
| InChI |
InChI=1/C10H7.BrH.Mg/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-7H;1H;/q-1;;+2/p-1 |
| CAS Registry Number |
703-55-9 |
| Molecular Structure |
|
| Boiling point |
221.5°C at 760 mmHg |
| Flash point |
78.9°C |
| Vapour Pressur |
0.159mmHg at 25°C |
| Hazard Symbols |
 F+:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R14:Reacts violently with water.;
R19:May form explosive peroxides.;
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S33:Take precautionary measures against static discharges.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) ;
|
