product Name |
2-Hydroxy-6-methoxyacetophenone |
Synonyms |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone |
Molecular Formula |
C9H10O3 |
Molecular Weight |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
CAS Registry Number |
703-23-1 |
EINECS |
211-872-9 |
Molecular Structure |
|
Density |
1.158g/cm3 |
Melting point |
58-60℃ |
Boiling point |
259.5°C at 760 mmHg |
Refractive index |
1.537 |
Flash point |
108.1°C |
Vapour Pressur |
0.00798mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|