| product Name |
2-Hydroxy-6-methoxyacetophenone |
| Synonyms |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| CAS Registry Number |
703-23-1 |
| EINECS |
211-872-9 |
| Molecular Structure |
|
| Density |
1.158g/cm3 |
| Melting point |
58-60℃ |
| Boiling point |
259.5°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
108.1°C |
| Vapour Pressur |
0.00798mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
